C9H13NO4 — CID 163912374
(4,5-dimethyl-2-oxooxolan-3-yl) 2-aminoprop-2-enoate (PubChem CID 163912374) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is (4,5-dimethyl-2-oxooxolan-3-yl) 2-aminoprop-2-enoate.
| Compound Name | (4,5-dimethyl-2-oxooxolan-3-yl) 2-aminoprop-2-enoate |
|---|---|
| PubChem CID | 163912374 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | (4,5-dimethyl-2-oxooxolan-3-yl) 2-aminoprop-2-enoate |
| SMILES | C=C(N)C(=O)OC1C(=O)OC(C)C1C |
| InChI | InChI=1S/C9H13NO4/c1-4-6(3)13-9(12)7(4)14-8(11)5(2)10/h4,6-7H,2,10H2,1,3H3 |
| InChIKey | QTGGMPFMFBQAKB-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|