C17H26O3Si — CID 10828507
(1'S,2'R,6'S,7'R)-5',7'-dimethyl-4'-trimethylsilylspiro[1,3-dioxolane-2,10'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one (PubChem CID 10828507) has the molecular formula C17H26O3Si and a molecular weight of 306.48 g/mol. Its IUPAC name is (1'S,2'R,6'S,7'R)-5',7'-dimethyl-4'-trimethylsilylspiro[1,3-dioxolane-2,10'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one.
| Compound Name | (1'S,2'R,6'S,7'R)-5',7'-dimethyl-4'-trimethylsilylspiro[1,3-dioxolane-2,10'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one |
|---|---|
| PubChem CID | 10828507 |
| Molecular Formula | C17H26O3Si |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (1'S,2'R,6'S,7'R)-5',7'-dimethyl-4'-trimethylsilylspiro[1,3-dioxolane-2,10'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one |
| SMILES | CC1=C([Si](C)(C)C)C(=O)[C@H]2[C@@H]3C4(CC[C@]3(C)[C@@H]12)OCCO4 |
| InChI | InChI=1S/C17H26O3Si/c1-10-12-11(13(18)14(10)21(3,4)5)15-16(12,2)6-7-17(15)19-8-9-20-17/h11-12,15H,6-9H2,1-5H3/t11-,12-,15-,16+/m0/s1 |
| InChIKey | WOHUIIUVSVBSSX-GVAFMPQTSA-N |
| XLogP | 3.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|