C15H20O3 — CID 10824452
(1'R,2'S,6'R,7'S)-1',4',5'-trimethylspiro[1,3-dioxolane-2,8'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one (PubChem CID 10824452) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (1'R,2'S,6'R,7'S)-1',4',5'-trimethylspiro[1,3-dioxolane-2,8'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one.
| Compound Name | (1'R,2'S,6'R,7'S)-1',4',5'-trimethylspiro[1,3-dioxolane-2,8'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one |
|---|---|
| PubChem CID | 10824452 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (1'R,2'S,6'R,7'S)-1',4',5'-trimethylspiro[1,3-dioxolane-2,8'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one |
| SMILES | CC1=C(C)[C@H]2[C@@H]3C4(CC[C@]3(C)[C@H]2C1=O)OCCO4 |
| InChI | InChI=1S/C15H20O3/c1-8-9(2)12(16)11-10(8)13-14(11,3)4-5-15(13)17-6-7-18-15/h10-11,13H,4-7H2,1-3H3/t10-,11-,13+,14-/m1/s1 |
| InChIKey | JIJJAUKQTSDEGM-MHDGFBEUSA-N |
| XLogP | 2.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |