C20H33LiO2 — CID 10828933
lithium [(2R)-2-(2-methoxypropan-2-yloxymethyl)nonyl]benzene (PubChem CID 10828933) has the molecular formula C20H33LiO2 and a molecular weight of 312.42 g/mol. Its IUPAC name is lithium [(2R)-2-(2-methoxypropan-2-yloxymethyl)nonyl]benzene.
| Compound Name | lithium [(2R)-2-(2-methoxypropan-2-yloxymethyl)nonyl]benzene |
|---|---|
| PubChem CID | 10828933 |
| Molecular Formula | C20H33LiO2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.26 |
| IUPAC Name | lithium [(2R)-2-(2-methoxypropan-2-yloxymethyl)nonyl]benzene |
| SMILES | CCCCCCC[C@@H]([CH-]c1ccccc1)COC(C)(C)OC.[Li+] |
| InChI | InChI=1S/C20H33O2.Li/c1-5-6-7-8-10-15-19(17-22-20(2,3)21-4)16-18-13-11-9-12-14-18;/h9,11-14,16,19H,5-8,10,15,17H2,1-4H3;/q-1;+1/t19-;/m0./s1 |
| InChIKey | JCMOAWGBXFJASQ-FYZYNONXSA-N |
| XLogP | 2.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|