C17H28LiN — CID 10444993
lithium (2S)-N,N-diethyl-2-(phenylmethyl)hexan-1-amine (PubChem CID 10444993) has the molecular formula C17H28LiN and a molecular weight of 253.36 g/mol. Its IUPAC name is lithium (2S)-N,N-diethyl-2-(phenylmethyl)hexan-1-amine.
| Compound Name | lithium (2S)-N,N-diethyl-2-(phenylmethyl)hexan-1-amine |
|---|---|
| PubChem CID | 10444993 |
| Molecular Formula | C17H28LiN |
| Molecular Weight | 253.36 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | lithium (2S)-N,N-diethyl-2-(phenylmethyl)hexan-1-amine |
| SMILES | CCCC[C@H]([CH-]c1ccccc1)CN(CC)CC.[Li+] |
| InChI | InChI=1S/C17H28N.Li/c1-4-7-11-17(15-18(5-2)6-3)14-16-12-9-8-10-13-16;/h8-10,12-14,17H,4-7,11,15H2,1-3H3;/q-1;+1/t17-;/m1./s1 |
| InChIKey | DNFRJIAVCMJKFD-UNTBIKODSA-N |
| XLogP | 1.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|