C18H19N5O2 — CID 10830763
(E,3E)-3-[(3-benzyl-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium-2-yl)imino]-1-methoxyprop-1-en-1-olate (PubChem CID 10830763) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is (E,3E)-3-[(3-benzyl-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium-2-yl)imino]-1-methoxyprop-1-en-1-olate.
| Compound Name | (E,3E)-3-[(3-benzyl-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium-2-yl)imino]-1-methoxyprop-1-en-1-olate |
|---|---|
| PubChem CID | 10830763 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (E,3E)-3-[(3-benzyl-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium-2-yl)imino]-1-methoxyprop-1-en-1-olate |
| SMILES | CO/C([O-])=C/C=N/c1nn2c(C)cc(C)nc2[n+]1Cc1ccccc1 |
| InChI | InChI=1S/C18H19N5O2/c1-13-11-14(2)23-18(20-13)22(12-15-7-5-4-6-8-15)17(21-23)19-10-9-16(24)25-3/h4-11H,12H2,1-3H3 |
| InChIKey | STTNDKFOGRUIMP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 78.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|