C20H22N5O4+ — CID 10715700
dimethyl 2-[(3-benzyl-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium-2-yl)amino]but-2-enedioate (PubChem CID 10715700) has the molecular formula C20H22N5O4+ and a molecular weight of 396.43 g/mol. Its IUPAC name is dimethyl 2-[(3-benzyl-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium-2-yl)amino]but-2-enedioate.
| Compound Name | dimethyl 2-[(3-benzyl-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium-2-yl)amino]but-2-enedioate |
|---|---|
| PubChem CID | 10715700 |
| Molecular Formula | C20H22N5O4+ |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | dimethyl 2-[(3-benzyl-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium-2-yl)amino]but-2-enedioate |
| SMILES | COC(=O)C=C(Nc1nn2c(C)cc(C)nc2[n+]1Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C20H21N5O4/c1-13-10-14(2)25-20(21-13)24(12-15-8-6-5-7-9-15)19(23-25)22-16(18(27)29-4)11-17(26)28-3/h5-11H,12H2,1-4H3/p+1 |
| InChIKey | BSDDNOXXOKQXPH-UHFFFAOYSA-O |
| XLogP | 1.32 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|