C15H19N5O4S — CID 10785057
methyl sulfate;3,5,7-trimethyl-N-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium-2-amine (PubChem CID 10785057) has the molecular formula C15H19N5O4S and a molecular weight of 365.42 g/mol. Its IUPAC name is methyl sulfate;3,5,7-trimethyl-N-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium-2-amine.
| Compound Name | methyl sulfate;3,5,7-trimethyl-N-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium-2-amine |
|---|---|
| PubChem CID | 10785057 |
| Molecular Formula | C15H19N5O4S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | methyl sulfate;3,5,7-trimethyl-N-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium-2-amine |
| SMILES | COS(=O)(=O)[O-].Cc1cc(C)n2nc(Nc3ccccc3)[n+](C)c2n1 |
| InChI | InChI=1S/C14H16N5.CH4O4S/c1-10-9-11(2)19-14(15-10)18(3)13(17-19)16-12-7-5-4-6-8-12;1-5-6(2,3)4/h4-9H,1-3H3,(H,16,17);1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | GJXSKCOYIHXLBB-UHFFFAOYSA-M |
| XLogP | 1.01 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|