C12H14N5+ — CID 839943
4,6,11,13-tetramethyl-3,7,8,10-tetraza-1-azoniatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene (PubChem CID 839943) has the molecular formula C12H14N5+ and a molecular weight of 228.28 g/mol. Its IUPAC name is 4,6,11,13-tetramethyl-3,7,8,10-tetraza-1-azoniatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene.
| Compound Name | 4,6,11,13-tetramethyl-3,7,8,10-tetraza-1-azoniatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene |
|---|---|
| PubChem CID | 839943 |
| Molecular Formula | C12H14N5+ |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 4,6,11,13-tetramethyl-3,7,8,10-tetraza-1-azoniatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene |
| SMILES | Cc1cc(C)[n+]2c(n1)nn1c(C)cc(C)nc12 |
| InChI | InChI=1S/C12H14N5/c1-7-5-9(3)16-11(13-7)15-17-10(4)6-8(2)14-12(16)17/h5-6H,1-4H3/q+1 |
| InChIKey | MYVUSSJWIDTZKH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 47.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|