C19H26N2O5 — CID 10832487
ethyl (2S,3S)-3-[[(2S)-4-methyl-1-oxo-1-phenylmethoxypentan-2-yl]carbamoyl]aziridine-2-carboxylate (PubChem CID 10832487) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is ethyl (2S,3S)-3-[[(2S)-4-methyl-1-oxo-1-phenylmethoxypentan-2-yl]carbamoyl]aziridine-2-carboxylate.
| Compound Name | ethyl (2S,3S)-3-[[(2S)-4-methyl-1-oxo-1-phenylmethoxypentan-2-yl]carbamoyl]aziridine-2-carboxylate |
|---|---|
| PubChem CID | 10832487 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | ethyl (2S,3S)-3-[[(2S)-4-methyl-1-oxo-1-phenylmethoxypentan-2-yl]carbamoyl]aziridine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1N[C@@H]1C(=O)N[C@@H](CC(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H26N2O5/c1-4-25-19(24)16-15(21-16)17(22)20-14(10-12(2)3)18(23)26-11-13-8-6-5-7-9-13/h5-9,12,14-16,21H,4,10-11H2,1-3H3,(H,20,22)/t14-,15-,16-/m0/s1 |
| InChIKey | WBOFUGRDYWLSCL-JYJNAYRXSA-N |
| XLogP | 1.16 |
| TPSA | 103.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|