C22H26O4S — CID 10834052
(4aR,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-hydroxy-7,7,10a-trimethyl-4-methylidene-4a,5,6,8-tetrahydrobenzo[8]annulen-3-one (PubChem CID 10834052) has the molecular formula C22H26O4S and a molecular weight of 386.51 g/mol. Its IUPAC name is (4aR,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-hydroxy-7,7,10a-trimethyl-4-methylidene-4a,5,6,8-tetrahydrobenzo[8]annulen-3-one.
| Compound Name | (4aR,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-hydroxy-7,7,10a-trimethyl-4-methylidene-4a,5,6,8-tetrahydrobenzo[8]annulen-3-one |
|---|---|
| PubChem CID | 10834052 |
| Molecular Formula | C22H26O4S |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (4aR,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-hydroxy-7,7,10a-trimethyl-4-methylidene-4a,5,6,8-tetrahydrobenzo[8]annulen-3-one |
| SMILES | C=C1C(=O)C=C[C@@]2(C)/C=C\[C@H](O)C(C)(C)C[C@@H](S(=O)(=O)c3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C22H26O4S/c1-15-17(23)10-12-22(4)13-11-19(24)21(2,3)14-18(20(15)22)27(25,26)16-8-6-5-7-9-16/h5-13,18-20,24H,1,14H2,2-4H3/b13-11-/t18-,19+,20-,22+/m1/s1 |
| InChIKey | BSIIWLYTWXFCNM-ZQWQWELGSA-N |
| XLogP | 3.49 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|