C21H42O4Si — CID 10834061
tert-butyl [(Z,2R,3R,4S)-1-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyloct-5-en-3-yl] carbonate (PubChem CID 10834061) has the molecular formula C21H42O4Si and a molecular weight of 386.65 g/mol. Its IUPAC name is tert-butyl [(Z,2R,3R,4S)-1-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyloct-5-en-3-yl] carbonate.
| Compound Name | tert-butyl [(Z,2R,3R,4S)-1-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyloct-5-en-3-yl] carbonate |
|---|---|
| PubChem CID | 10834061 |
| Molecular Formula | C21H42O4Si |
| Molecular Weight | 386.65 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | tert-butyl [(Z,2R,3R,4S)-1-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyloct-5-en-3-yl] carbonate |
| SMILES | CC/C=C\[C@H](C)[C@@H](OC(=O)OC(C)(C)C)[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O4Si/c1-12-13-14-16(2)18(24-19(22)25-20(4,5)6)17(3)15-23-26(10,11)21(7,8)9/h13-14,16-18H,12,15H2,1-11H3/b14-13-/t16-,17+,18+/m0/s1 |
| InChIKey | UZFJBPYAALGLBC-RXMKWERKSA-N |
| XLogP | 6.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.65 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|