C20H44O3Si2 — CID 154718521
tert-butyl-[(Z,2S,3R,4S)-3-(methoxymethoxy)-2,4-dimethyl-6-trimethylsilylhept-5-enoxy]-dimethylsilane (PubChem CID 154718521) has the molecular formula C20H44O3Si2 and a molecular weight of 388.74 g/mol. Its IUPAC name is tert-butyl-[(Z,2S,3R,4S)-3-(methoxymethoxy)-2,4-dimethyl-6-trimethylsilylhept-5-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z,2S,3R,4S)-3-(methoxymethoxy)-2,4-dimethyl-6-trimethylsilylhept-5-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 154718521 |
| Molecular Formula | C20H44O3Si2 |
| Molecular Weight | 388.74 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | tert-butyl-[(Z,2S,3R,4S)-3-(methoxymethoxy)-2,4-dimethyl-6-trimethylsilylhept-5-enoxy]-dimethylsilane |
| SMILES | COCO[C@H]([C@@H](C)/C=C(/C)[Si](C)(C)C)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H44O3Si2/c1-16(13-18(3)24(8,9)10)19(22-15-21-7)17(2)14-23-25(11,12)20(4,5)6/h13,16-17,19H,14-15H2,1-12H3/b18-13-/t16-,17-,19+/m0/s1 |
| InChIKey | WUNOONZARVFZSQ-BZBPSAPESA-N |
| XLogP | 6.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.74 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|