C17H35IO4Si — CID 46188285
tert-butyl-[(E,2S,3S,4R)-6-iodo-1-methoxy-3-(methoxymethoxy)-4-methylhept-5-en-2-yl]oxy-dimethylsilane (PubChem CID 46188285) has the molecular formula C17H35IO4Si and a molecular weight of 458.45 g/mol. Its IUPAC name is tert-butyl-[(E,2S,3S,4R)-6-iodo-1-methoxy-3-(methoxymethoxy)-4-methylhept-5-en-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,2S,3S,4R)-6-iodo-1-methoxy-3-(methoxymethoxy)-4-methylhept-5-en-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 46188285 |
| Molecular Formula | C17H35IO4Si |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | tert-butyl-[(E,2S,3S,4R)-6-iodo-1-methoxy-3-(methoxymethoxy)-4-methylhept-5-en-2-yl]oxy-dimethylsilane |
| SMILES | COCO[C@@H]([C@H](C)/C=C(\C)I)[C@H](COC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H35IO4Si/c1-13(10-14(2)18)16(21-12-20-7)15(11-19-6)22-23(8,9)17(3,4)5/h10,13,15-16H,11-12H2,1-9H3/b14-10+/t13-,15+,16+/m1/s1 |
| InChIKey | JBKBVBQIZJERBK-QUQBVAGWSA-N |
| XLogP | 4.99 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|