C16H33IO2Si — CID 50993097
tert-butyl-[(E,2R,3R,4S)-7-iodo-3-methoxy-4,6-dimethylhept-5-en-2-yl]oxy-dimethylsilane (PubChem CID 50993097) has the molecular formula C16H33IO2Si and a molecular weight of 412.43 g/mol. Its IUPAC name is tert-butyl-[(E,2R,3R,4S)-7-iodo-3-methoxy-4,6-dimethylhept-5-en-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,2R,3R,4S)-7-iodo-3-methoxy-4,6-dimethylhept-5-en-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 50993097 |
| Molecular Formula | C16H33IO2Si |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | tert-butyl-[(E,2R,3R,4S)-7-iodo-3-methoxy-4,6-dimethylhept-5-en-2-yl]oxy-dimethylsilane |
| SMILES | CO[C@H]([C@@H](C)/C=C(\C)CI)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H33IO2Si/c1-12(11-17)10-13(2)15(18-7)14(3)19-20(8,9)16(4,5)6/h10,13-15H,11H2,1-9H3/b12-10+/t13-,14+,15+/m0/s1 |
| InChIKey | YXGWBNMYAWNBGO-HUIIYUSISA-N |
| XLogP | 5.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|