C18H36O4Si — CID 11717171
tert-butyl [(4R,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-en-4-yl] carbonate (PubChem CID 11717171) has the molecular formula C18H36O4Si and a molecular weight of 344.57 g/mol. Its IUPAC name is tert-butyl [(4R,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-en-4-yl] carbonate.
| Compound Name | tert-butyl [(4R,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-en-4-yl] carbonate |
|---|---|
| PubChem CID | 11717171 |
| Molecular Formula | C18H36O4Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | tert-butyl [(4R,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-en-4-yl] carbonate |
| SMILES | C=CC[C@H](C[C@H](C)O[Si](C)(C)C(C)(C)C)OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H36O4Si/c1-11-12-15(20-16(19)21-17(3,4)5)13-14(2)22-23(9,10)18(6,7)8/h11,14-15H,1,12-13H2,2-10H3/t14-,15+/m0/s1 |
| InChIKey | LELZSXIMTCESGB-LSDHHAIUSA-N |
| XLogP | 5.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|