C16H32O4Si — CID 135003004
tert-butyl 5-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl carbonate (PubChem CID 135003004) has the molecular formula C16H32O4Si and a molecular weight of 316.51 g/mol. Its IUPAC name is tert-butyl 5-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl carbonate.
| Compound Name | tert-butyl 5-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl carbonate |
|---|---|
| PubChem CID | 135003004 |
| Molecular Formula | C16H32O4Si |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | tert-butyl 5-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl carbonate |
| SMILES | C=CC(CCO[Si](C)(C)C(C)(C)C)OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H32O4Si/c1-10-13(19-14(17)20-15(2,3)4)11-12-18-21(8,9)16(5,6)7/h10,13H,1,11-12H2,2-9H3 |
| InChIKey | UOLDVAQYGZHOBM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|