C20H33N2PSi2 — CID 10834173
3-[dimethylamino(phenyl)phosphanyl]-N,N-bis(trimethylsilyl)aniline (PubChem CID 10834173) has the molecular formula C20H33N2PSi2 and a molecular weight of 388.64 g/mol. Its IUPAC name is 3-[dimethylamino(phenyl)phosphanyl]-N,N-bis(trimethylsilyl)aniline.
| Compound Name | 3-[dimethylamino(phenyl)phosphanyl]-N,N-bis(trimethylsilyl)aniline |
|---|---|
| PubChem CID | 10834173 |
| Molecular Formula | C20H33N2PSi2 |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 3-[dimethylamino(phenyl)phosphanyl]-N,N-bis(trimethylsilyl)aniline |
| SMILES | CN(C)P(c1ccccc1)c1cccc(N([Si](C)(C)C)[Si](C)(C)C)c1 |
| InChI | InChI=1S/C20H33N2PSi2/c1-21(2)23(19-14-10-9-11-15-19)20-16-12-13-18(17-20)22(24(3,4)5)25(6,7)8/h9-17H,1-8H3 |
| InChIKey | QZFFOCHCNTWYML-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|