C18H40N2Si4 — CID 15443940
1-N,1-N,3-N,3-N-tetrakis(trimethylsilyl)benzene-1,3-diamine (PubChem CID 15443940) has the molecular formula C18H40N2Si4 and a molecular weight of 396.88 g/mol. Its IUPAC name is 1-N,1-N,3-N,3-N-tetrakis(trimethylsilyl)benzene-1,3-diamine.
| Compound Name | 1-N,1-N,3-N,3-N-tetrakis(trimethylsilyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 15443940 |
| Molecular Formula | C18H40N2Si4 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 1-N,1-N,3-N,3-N-tetrakis(trimethylsilyl)benzene-1,3-diamine |
| SMILES | C[Si](C)(C)N(c1cccc(N([Si](C)(C)C)[Si](C)(C)C)c1)[Si](C)(C)C |
| InChI | InChI=1S/C18H40N2Si4/c1-21(2,3)19(22(4,5)6)17-14-13-15-18(16-17)20(23(7,8)9)24(10,11)12/h13-16H,1-12H3 |
| InChIKey | VOLZDZPLYOEYCO-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|