C10H12BNO2 — CID 140881603
3-(1,3,2-dioxaborol-2-yl)-N,N-dimethylaniline (PubChem CID 140881603) has the molecular formula C10H12BNO2 and a molecular weight of 189.02 g/mol. Its IUPAC name is 3-(1,3,2-dioxaborol-2-yl)-N,N-dimethylaniline.
| Compound Name | 3-(1,3,2-dioxaborol-2-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 140881603 |
| Molecular Formula | C10H12BNO2 |
| Molecular Weight | 189.02 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 3-(1,3,2-dioxaborol-2-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(B2OC=CO2)c1 |
| InChI | InChI=1S/C10H12BNO2/c1-12(2)10-5-3-4-9(8-10)11-13-6-7-14-11/h3-8H,1-2H3 |
| InChIKey | KEYVEXOVGIEXMD-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.02 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|