About (N-methylanilino)azanide
(N-methylanilino)azanide (PubChem CID 163517581) has the molecular formula C7H9N2-
and a molecular weight of 121.16 g/mol. Its IUPAC name is (N-methylanilino)azanide.
Molecular Properties
| Compound Name | (N-methylanilino)azanide |
| PubChem CID | 163517581 |
| Molecular Formula | C7H9N2- |
| Molecular Weight | 121.16 g/mol |
| Exact Mass | 121.08 |
| IUPAC Name | (N-methylanilino)azanide |
| SMILES | CN([NH-])c1ccccc1 |
| InChI | InChI=1S/C7H9N2/c1-9(8)7-5-3-2-4-6-7/h2-6,8H,1H3/q-1 |
| InChIKey | ZWAZLXJWUVJQKZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 27.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.16 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (N-methylanilino)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (N-methylanilino)azanide?
The IUPAC name of (N-methylanilino)azanide (CID 163517581) is (N-methylanilino)azanide.
What is the SMILES notation for (N-methylanilino)azanide?
The canonical SMILES for (N-methylanilino)azanide is CN([NH-])c1ccccc1.
What is the InChIKey of (N-methylanilino)azanide?
The InChIKey is ZWAZLXJWUVJQKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N2/c1-9(8)7-5-3-2-4-6-7/h2-6,8H,1H3/q-1.
What are the key properties of (N-methylanilino)azanide?
(N-methylanilino)azanide has a molecular weight of 121.16 g/mol, XLogP of 2.09, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (N-methylanilino)azanide is sourced from PubChem (CID 163517581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).