C22H25F2N3O4S — CID 10837890
2-(2,4-difluorophenyl)-3-methyl-3-(2-phenylmethoxyethylsulfonyl)-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 10837890) has the molecular formula C22H25F2N3O4S and a molecular weight of 465.52 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-3-methyl-3-(2-phenylmethoxyethylsulfonyl)-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-3-methyl-3-(2-phenylmethoxyethylsulfonyl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 10837890 |
| Molecular Formula | C22H25F2N3O4S |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 2-(2,4-difluorophenyl)-3-methyl-3-(2-phenylmethoxyethylsulfonyl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | CC(C)(C(O)(Cn1cncn1)c1ccc(F)cc1F)S(=O)(=O)CCOCc1ccccc1 |
| InChI | InChI=1S/C22H25F2N3O4S/c1-21(2,32(29,30)11-10-31-13-17-6-4-3-5-7-17)22(28,14-27-16-25-15-26-27)19-9-8-18(23)12-20(19)24/h3-9,12,15-16,28H,10-11,13-14H2,1-2H3 |
| InChIKey | RHEJPEGIXGWWAI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|