C26H46O5Si — CID 10837957
methyl (2E,4E,6R)-6-[tert-butyl(dimethyl)silyl]oxy-6-[(2R)-2-butyl-1,10-dioxaspiro[4.5]decan-2-yl]-3-methylhexa-2,4-dienoate (PubChem CID 10837957) has the molecular formula C26H46O5Si and a molecular weight of 466.74 g/mol. Its IUPAC name is methyl (2E,4E,6R)-6-[tert-butyl(dimethyl)silyl]oxy-6-[(2R)-2-butyl-1,10-dioxaspiro[4.5]decan-2-yl]-3-methylhexa-2,4-dienoate.
| Compound Name | methyl (2E,4E,6R)-6-[tert-butyl(dimethyl)silyl]oxy-6-[(2R)-2-butyl-1,10-dioxaspiro[4.5]decan-2-yl]-3-methylhexa-2,4-dienoate |
|---|---|
| PubChem CID | 10837957 |
| Molecular Formula | C26H46O5Si |
| Molecular Weight | 466.74 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | methyl (2E,4E,6R)-6-[tert-butyl(dimethyl)silyl]oxy-6-[(2R)-2-butyl-1,10-dioxaspiro[4.5]decan-2-yl]-3-methylhexa-2,4-dienoate |
| SMILES | CCCC[C@]1([C@@H](/C=C/C(C)=C/C(=O)OC)O[Si](C)(C)C(C)(C)C)CCC2(CCCCO2)O1 |
| InChI | InChI=1S/C26H46O5Si/c1-9-10-15-25(17-18-26(31-25)16-11-12-19-29-26)22(30-32(7,8)24(3,4)5)14-13-21(2)20-23(27)28-6/h13-14,20,22H,9-12,15-19H2,1-8H3/b14-13+,21-20+/t22-,25-,26?/m1/s1 |
| InChIKey | ZYMBENJYHBUGEC-IGSQHZHCSA-N |
| XLogP | 6.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.74 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|