C24H26N2O5S3 — CID 10839654
(4Z)-4-[(2Z)-2-(3-ethyl-1,3-benzoxazol-2-ylidene)ethylidene]-2-ethylsulfanyl-3-methyl-1,3-thiazol-3-ium-5-one;4-methylbenzenesulfonate (PubChem CID 10839654) has the molecular formula C24H26N2O5S3 and a molecular weight of 518.68 g/mol. Its IUPAC name is (4Z)-4-[(2Z)-2-(3-ethyl-1,3-benzoxazol-2-ylidene)ethylidene]-2-ethylsulfanyl-3-methyl-1,3-thiazol-3-ium-5-one;4-methylbenzenesulfonate.
| Compound Name | (4Z)-4-[(2Z)-2-(3-ethyl-1,3-benzoxazol-2-ylidene)ethylidene]-2-ethylsulfanyl-3-methyl-1,3-thiazol-3-ium-5-one;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10839654 |
| Molecular Formula | C24H26N2O5S3 |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | (4Z)-4-[(2Z)-2-(3-ethyl-1,3-benzoxazol-2-ylidene)ethylidene]-2-ethylsulfanyl-3-methyl-1,3-thiazol-3-ium-5-one;4-methylbenzenesulfonate |
| SMILES | CCSC1=[N+](C)/C(=C\C=C2/Oc3ccccc3N2CC)C(=O)S1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C17H19N2O2S2.C7H8O3S/c1-4-19-12-8-6-7-9-14(12)21-15(19)11-10-13-16(20)23-17(18(13)3)22-5-2;1-6-2-4-7(5-3-6)11(8,9)10/h6-11H,4-5H2,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1/b13-10-,15-11-; |
| InChIKey | JOVNLGUEYYAASK-BDDGWQBOSA-M |
| XLogP | 4.55 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|