C30H30N2O5S — CID 44669753
(2Z)-3-ethyl-2-[3-(3-ethyl-1,3-benzoxazol-3-ium-2-yl)cyclopent-2-en-1-ylidene]-1,3-benzoxazole;4-methylbenzenesulfonate (PubChem CID 44669753) has the molecular formula C30H30N2O5S and a molecular weight of 530.65 g/mol. Its IUPAC name is (2Z)-3-ethyl-2-[3-(3-ethyl-1,3-benzoxazol-3-ium-2-yl)cyclopent-2-en-1-ylidene]-1,3-benzoxazole;4-methylbenzenesulfonate.
| Compound Name | (2Z)-3-ethyl-2-[3-(3-ethyl-1,3-benzoxazol-3-ium-2-yl)cyclopent-2-en-1-ylidene]-1,3-benzoxazole;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 44669753 |
| Molecular Formula | C30H30N2O5S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | (2Z)-3-ethyl-2-[3-(3-ethyl-1,3-benzoxazol-3-ium-2-yl)cyclopent-2-en-1-ylidene]-1,3-benzoxazole;4-methylbenzenesulfonate |
| SMILES | CCN1/C(=C2/C=C(c3oc4ccccc4[n+]3CC)CC2)Oc2ccccc21.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C23H23N2O2.C7H8O3S/c1-3-24-18-9-5-7-11-20(18)26-22(24)16-13-14-17(15-16)23-25(4-2)19-10-6-8-12-21(19)27-23;1-6-2-4-7(5-3-6)11(8,9)10/h5-12,15H,3-4,13-14H2,1-2H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | JCQMGFIPWVZGAZ-UHFFFAOYSA-M |
| XLogP | 5.95 |
| TPSA | 86.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|