C11H14OS — CID 10845505
3-(4-methylphenyl)-1,4-oxathiane (PubChem CID 10845505) has the molecular formula C11H14OS and a molecular weight of 194.30 g/mol. Its IUPAC name is 3-(4-methylphenyl)-1,4-oxathiane.
| Compound Name | 3-(4-methylphenyl)-1,4-oxathiane |
|---|---|
| PubChem CID | 10845505 |
| Molecular Formula | C11H14OS |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 3-(4-methylphenyl)-1,4-oxathiane |
| SMILES | Cc1ccc(C2COCCS2)cc1 |
| InChI | InChI=1S/C11H14OS/c1-9-2-4-10(5-3-9)11-8-12-6-7-13-11/h2-5,11H,6-8H2,1H3 |
| InChIKey | HUDVAEOQYDMGIY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |