C12H13ClO2 — CID 10846804
(3R,6S)-3-chloro-6-phenylmethoxy-3,6-dihydro-2H-pyran (PubChem CID 10846804) has the molecular formula C12H13ClO2 and a molecular weight of 224.69 g/mol. Its IUPAC name is (3R,6S)-3-chloro-6-phenylmethoxy-3,6-dihydro-2H-pyran.
| Compound Name | (3R,6S)-3-chloro-6-phenylmethoxy-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 10846804 |
| Molecular Formula | C12H13ClO2 |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | (3R,6S)-3-chloro-6-phenylmethoxy-3,6-dihydro-2H-pyran |
| SMILES | Cl[C@@H]1C=C[C@@H](OCc2ccccc2)OC1 |
| InChI | InChI=1S/C12H13ClO2/c13-11-6-7-12(15-9-11)14-8-10-4-2-1-3-5-10/h1-7,11-12H,8-9H2/t11-,12+/m1/s1 |
| InChIKey | DTDZGSTVQNOXHV-NEPJUHHUSA-N |
| XLogP | 2.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|