C19H21FO4 — CID 15489662
(3S,4R,5S)-5-fluoro-3,4-bis(phenylmethoxy)oxan-2-ol (PubChem CID 15489662) has the molecular formula C19H21FO4 and a molecular weight of 332.37 g/mol. Its IUPAC name is (3S,4R,5S)-5-fluoro-3,4-bis(phenylmethoxy)oxan-2-ol.
| Compound Name | (3S,4R,5S)-5-fluoro-3,4-bis(phenylmethoxy)oxan-2-ol |
|---|---|
| PubChem CID | 15489662 |
| Molecular Formula | C19H21FO4 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (3S,4R,5S)-5-fluoro-3,4-bis(phenylmethoxy)oxan-2-ol |
| SMILES | OC1OCC(F)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C19H21FO4/c20-16-13-24-19(21)18(23-12-15-9-5-2-6-10-15)17(16)22-11-14-7-3-1-4-8-14/h1-10,16-19,21H,11-13H2/t16?,17-,18-,19?/m0/s1 |
| InChIKey | ZKKYYASFHRQTJO-YBXZHIRMSA-N |
| XLogP | 2.84 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |