C12H14O3 — CID 11275756
(3S,6R)-6-phenylmethoxy-3,6-dihydro-2H-pyran-3-ol (PubChem CID 11275756) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (3S,6R)-6-phenylmethoxy-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (3S,6R)-6-phenylmethoxy-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 11275756 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (3S,6R)-6-phenylmethoxy-3,6-dihydro-2H-pyran-3-ol |
| SMILES | O[C@H]1C=C[C@H](OCc2ccccc2)OC1 |
| InChI | InChI=1S/C12H14O3/c13-11-6-7-12(15-9-11)14-8-10-4-2-1-3-5-10/h1-7,11-13H,8-9H2/t11-,12+/m0/s1 |
| InChIKey | RTCUYMOZAGDJBR-NWDGAFQWSA-N |
| XLogP | 1.48 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|