C11H24OSi2 — CID 10846986
trimethyl-(2-trimethylsilyl-3,4-dihydro-2H-pyran-6-yl)silane (PubChem CID 10846986) has the molecular formula C11H24OSi2 and a molecular weight of 228.48 g/mol. Its IUPAC name is trimethyl-(2-trimethylsilyl-3,4-dihydro-2H-pyran-6-yl)silane.
| Compound Name | trimethyl-(2-trimethylsilyl-3,4-dihydro-2H-pyran-6-yl)silane |
|---|---|
| PubChem CID | 10846986 |
| Molecular Formula | C11H24OSi2 |
| Molecular Weight | 228.48 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | trimethyl-(2-trimethylsilyl-3,4-dihydro-2H-pyran-6-yl)silane |
| SMILES | C[Si](C)(C)C1=CCCC([Si](C)(C)C)O1 |
| InChI | InChI=1S/C11H24OSi2/c1-13(2,3)10-8-7-9-11(12-10)14(4,5)6/h8,11H,7,9H2,1-6H3 |
| InChIKey | HBEQVJGMGBAQNG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|