C13H10N4O2S — CID 10850760
(2Z)-2-(1H-benzimidazol-2-ylhydrazinylidene)-2-thiophen-3-ylacetic acid (PubChem CID 10850760) has the molecular formula C13H10N4O2S and a molecular weight of 286.32 g/mol. Its IUPAC name is (2Z)-2-(1H-benzimidazol-2-ylhydrazinylidene)-2-thiophen-3-ylacetic acid.
| Compound Name | (2Z)-2-(1H-benzimidazol-2-ylhydrazinylidene)-2-thiophen-3-ylacetic acid |
|---|---|
| PubChem CID | 10850760 |
| Molecular Formula | C13H10N4O2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | (2Z)-2-(1H-benzimidazol-2-ylhydrazinylidene)-2-thiophen-3-ylacetic acid |
| SMILES | O=C(O)/C(=N\Nc1nc2ccccc2[nH]1)c1ccsc1 |
| InChI | InChI=1S/C13H10N4O2S/c18-12(19)11(8-5-6-20-7-8)16-17-13-14-9-3-1-2-4-10(9)15-13/h1-7H,(H,18,19)(H2,14,15,17)/b16-11- |
| InChIKey | XUCKJXQMDWVFID-WJDWOHSUSA-N |
| XLogP | 2.53 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|