C18H27N3O2 — CID 108508905
2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-benzyl-2-oxoacetamide (PubChem CID 108508905) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-benzyl-2-oxoacetamide.
| Compound Name | 2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-benzyl-2-oxoacetamide |
|---|---|
| PubChem CID | 108508905 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-benzyl-2-oxoacetamide |
| SMILES | CC1(C)CC(N)CC(C)(C)N1C(=O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C18H27N3O2/c1-17(2)10-14(19)11-18(3,4)21(17)16(23)15(22)20-12-13-8-6-5-7-9-13/h5-9,14H,10-12,19H2,1-4H3,(H,20,22) |
| InChIKey | XCFVGIUKAGXWAY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|