C12H23N3O2 — CID 108522425
2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-methyl-2-oxoacetamide (PubChem CID 108522425) has the molecular formula C12H23N3O2 and a molecular weight of 241.33 g/mol. Its IUPAC name is 2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-methyl-2-oxoacetamide.
| Compound Name | 2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-methyl-2-oxoacetamide |
|---|---|
| PubChem CID | 108522425 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-methyl-2-oxoacetamide |
| SMILES | CNC(=O)C(=O)N1C(C)(C)CC(N)CC1(C)C |
| InChI | InChI=1S/C12H23N3O2/c1-11(2)6-8(13)7-12(3,4)15(11)10(17)9(16)14-5/h8H,6-7,13H2,1-5H3,(H,14,16) |
| InChIKey | DDFVYLSWDDOJTC-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|