C17H23Cl2N3O2 — CID 108522597
2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-(2,6-dichlorophenyl)-2-oxoacetamide (PubChem CID 108522597) has the molecular formula C17H23Cl2N3O2 and a molecular weight of 372.30 g/mol. Its IUPAC name is 2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-(2,6-dichlorophenyl)-2-oxoacetamide.
| Compound Name | 2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-(2,6-dichlorophenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108522597 |
| Molecular Formula | C17H23Cl2N3O2 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-(2,6-dichlorophenyl)-2-oxoacetamide |
| SMILES | CC1(C)CC(N)CC(C)(C)N1C(=O)C(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H23Cl2N3O2/c1-16(2)8-10(20)9-17(3,4)22(16)15(24)14(23)21-13-11(18)6-5-7-12(13)19/h5-7,10H,8-9,20H2,1-4H3,(H,21,23) |
| InChIKey | UXYSAKWQIFBBKU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|