C15H29N3O4 — CID 108522506
2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-(2,2-dimethoxyethyl)-2-oxoacetamide (PubChem CID 108522506) has the molecular formula C15H29N3O4 and a molecular weight of 315.41 g/mol. Its IUPAC name is 2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-(2,2-dimethoxyethyl)-2-oxoacetamide.
| Compound Name | 2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-(2,2-dimethoxyethyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108522506 |
| Molecular Formula | C15H29N3O4 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-(2,2-dimethoxyethyl)-2-oxoacetamide |
| SMILES | COC(CNC(=O)C(=O)N1C(C)(C)CC(N)CC1(C)C)OC |
| InChI | InChI=1S/C15H29N3O4/c1-14(2)7-10(16)8-15(3,4)18(14)13(20)12(19)17-9-11(21-5)22-6/h10-11H,7-9,16H2,1-6H3,(H,17,19) |
| InChIKey | SOXPMEFSTVBTFV-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|