C19H37N3O2 — CID 108522531
2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N,N-bis(2-methylpropyl)-2-oxoacetamide (PubChem CID 108522531) has the molecular formula C19H37N3O2 and a molecular weight of 339.52 g/mol. Its IUPAC name is 2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N,N-bis(2-methylpropyl)-2-oxoacetamide.
| Compound Name | 2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N,N-bis(2-methylpropyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108522531 |
| Molecular Formula | C19H37N3O2 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.29 |
| IUPAC Name | 2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N,N-bis(2-methylpropyl)-2-oxoacetamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)C(=O)N1C(C)(C)CC(N)CC1(C)C |
| InChI | InChI=1S/C19H37N3O2/c1-13(2)11-21(12-14(3)4)16(23)17(24)22-18(5,6)9-15(20)10-19(22,7)8/h13-15H,9-12,20H2,1-8H3 |
| InChIKey | NKXNOKRCXJQLKZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|