C18H24F3N3O2 — CID 108522648
2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-2-oxo-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 108522648) has the molecular formula C18H24F3N3O2 and a molecular weight of 371.40 g/mol. Its IUPAC name is 2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-2-oxo-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-2-oxo-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 108522648 |
| Molecular Formula | C18H24F3N3O2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 2-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-2-oxo-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC1(C)CC(N)CC(C)(C)N1C(=O)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H24F3N3O2/c1-16(2)9-12(22)10-17(3,4)24(16)15(26)14(25)23-13-7-5-11(6-8-13)18(19,20)21/h5-8,12H,9-10,22H2,1-4H3,(H,23,25) |
| InChIKey | YFKUXCNRRWWFHA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|