C22H28N2O3 — CID 108509023
N-(4-acetylphenyl)-N'-[1-(1-adamantyl)ethyl]oxamide (PubChem CID 108509023) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-(4-acetylphenyl)-N'-[1-(1-adamantyl)ethyl]oxamide.
| Compound Name | N-(4-acetylphenyl)-N'-[1-(1-adamantyl)ethyl]oxamide |
|---|---|
| PubChem CID | 108509023 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | N-(4-acetylphenyl)-N'-[1-(1-adamantyl)ethyl]oxamide |
| SMILES | CC(=O)c1ccc(NC(=O)C(=O)NC(C)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C22H28N2O3/c1-13(25)18-3-5-19(6-4-18)24-21(27)20(26)23-14(2)22-10-15-7-16(11-22)9-17(8-15)12-22/h3-6,14-17H,7-12H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | VDOWLZHCJYPOMP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|