About N'-acetyl-N'-(2-aminoethyl)-N-benzyl-N-methyloxamide
N'-acetyl-N'-(2-aminoethyl)-N-benzyl-N-methyloxamide (PubChem CID 108518840) has the molecular formula C14H19N3O3
and a molecular weight of 277.32 g/mol. Its IUPAC name is N'-acetyl-N'-(2-aminoethyl)-N-benzyl-N-methyloxamide.
Molecular Properties
| Compound Name | N'-acetyl-N'-(2-aminoethyl)-N-benzyl-N-methyloxamide |
| PubChem CID | 108518840 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | N'-acetyl-N'-(2-aminoethyl)-N-benzyl-N-methyloxamide |
| SMILES | CC(=O)N(CCN)C(=O)C(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C14H19N3O3/c1-11(18)17(9-8-15)14(20)13(19)16(2)10-12-6-4-3-5-7-12/h3-7H,8-10,15H2,1-2H3 |
| InChIKey | DEVIDGBSBMZDQI-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-acetyl-N'-(2-aminoethyl)-N-benzyl-N-methyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-acetyl-N'-(2-aminoethyl)-N-benzyl-N-methyloxamide?
The IUPAC name of N'-acetyl-N'-(2-aminoethyl)-N-benzyl-N-methyloxamide (CID 108518840) is N'-acetyl-N'-(2-aminoethyl)-N-benzyl-N-methyloxamide.
What is the SMILES notation for N'-acetyl-N'-(2-aminoethyl)-N-benzyl-N-methyloxamide?
The canonical SMILES for N'-acetyl-N'-(2-aminoethyl)-N-benzyl-N-methyloxamide is CC(=O)N(CCN)C(=O)C(=O)N(C)Cc1ccccc1.
What is the InChIKey of N'-acetyl-N'-(2-aminoethyl)-N-benzyl-N-methyloxamide?
The InChIKey is DEVIDGBSBMZDQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O3/c1-11(18)17(9-8-15)14(20)13(19)16(2)10-12-6-4-3-5-7-12/h3-7H,8-10,15H2,1-2H3.
What are the key properties of N'-acetyl-N'-(2-aminoethyl)-N-benzyl-N-methyloxamide?
N'-acetyl-N'-(2-aminoethyl)-N-benzyl-N-methyloxamide has a molecular weight of 277.32 g/mol, XLogP of -0.02, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-acetyl-N'-(2-aminoethyl)-N-benzyl-N-methyloxamide is sourced from PubChem (CID 108518840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).