C17H30O3Si — CID 10852479
1-[(1R,2S,3R,4R)-3-methoxy-5,8,8-trimethyl-1-trimethylsilyloxy-2-bicyclo[2.2.2]oct-5-enyl]ethanone (PubChem CID 10852479) has the molecular formula C17H30O3Si and a molecular weight of 310.51 g/mol. Its IUPAC name is 1-[(1R,2S,3R,4R)-3-methoxy-5,8,8-trimethyl-1-trimethylsilyloxy-2-bicyclo[2.2.2]oct-5-enyl]ethanone.
| Compound Name | 1-[(1R,2S,3R,4R)-3-methoxy-5,8,8-trimethyl-1-trimethylsilyloxy-2-bicyclo[2.2.2]oct-5-enyl]ethanone |
|---|---|
| PubChem CID | 10852479 |
| Molecular Formula | C17H30O3Si |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 1-[(1R,2S,3R,4R)-3-methoxy-5,8,8-trimethyl-1-trimethylsilyloxy-2-bicyclo[2.2.2]oct-5-enyl]ethanone |
| SMILES | CO[C@@H]1[C@H]2C(C)=C[C@](O[Si](C)(C)C)(CC2(C)C)[C@H]1C(C)=O |
| InChI | InChI=1S/C17H30O3Si/c1-11-9-17(20-21(6,7)8)10-16(3,4)13(11)15(19-5)14(17)12(2)18/h9,13-15H,10H2,1-8H3/t13-,14+,15-,17+/m1/s1 |
| InChIKey | KKGGJJIMBSHPHD-DLTWYDFYSA-N |
| XLogP | 3.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|