C20H22N4O3 — CID 108525493
N'-(4-aminophenyl)-N'-phenyl-N-(piperidine-4-carbonyl)oxamide (PubChem CID 108525493) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is N'-(4-aminophenyl)-N'-phenyl-N-(piperidine-4-carbonyl)oxamide.
| Compound Name | N'-(4-aminophenyl)-N'-phenyl-N-(piperidine-4-carbonyl)oxamide |
|---|---|
| PubChem CID | 108525493 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N'-(4-aminophenyl)-N'-phenyl-N-(piperidine-4-carbonyl)oxamide |
| SMILES | Nc1ccc(N(C(=O)C(=O)NC(=O)C2CCNCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H22N4O3/c21-15-6-8-17(9-7-15)24(16-4-2-1-3-5-16)20(27)19(26)23-18(25)14-10-12-22-13-11-14/h1-9,14,22H,10-13,21H2,(H,23,25,26) |
| InChIKey | ZEJLQDIPHGTYGJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|