C21H23N5O2 — CID 108530132
2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(1H-indazol-6-yl)-2-oxoacetamide (PubChem CID 108530132) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(1H-indazol-6-yl)-2-oxoacetamide.
| Compound Name | 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(1H-indazol-6-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108530132 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(1H-indazol-6-yl)-2-oxoacetamide |
| SMILES | Cc1cccc(N2CCN(C(=O)C(=O)Nc3ccc4cn[nH]c4c3)CC2)c1C |
| InChI | InChI=1S/C21H23N5O2/c1-14-4-3-5-19(15(14)2)25-8-10-26(11-9-25)21(28)20(27)23-17-7-6-16-13-22-24-18(16)12-17/h3-7,12-13H,8-11H2,1-2H3,(H,22,24)(H,23,27) |
| InChIKey | QMAXVKKURBIEHN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|