C20H22O2S — CID 10853596
(4R,5R)-2,2-dimethyl-5-(2-phenylethyl)-4-phenylsulfanyloxolan-3-one (PubChem CID 10853596) has the molecular formula C20H22O2S and a molecular weight of 326.46 g/mol. Its IUPAC name is (4R,5R)-2,2-dimethyl-5-(2-phenylethyl)-4-phenylsulfanyloxolan-3-one.
| Compound Name | (4R,5R)-2,2-dimethyl-5-(2-phenylethyl)-4-phenylsulfanyloxolan-3-one |
|---|---|
| PubChem CID | 10853596 |
| Molecular Formula | C20H22O2S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (4R,5R)-2,2-dimethyl-5-(2-phenylethyl)-4-phenylsulfanyloxolan-3-one |
| SMILES | CC1(C)O[C@H](CCc2ccccc2)[C@@H](Sc2ccccc2)C1=O |
| InChI | InChI=1S/C20H22O2S/c1-20(2)19(21)18(23-16-11-7-4-8-12-16)17(22-20)14-13-15-9-5-3-6-10-15/h3-12,17-18H,13-14H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | BZGLLXFOPCFJCM-QZTJIDSGSA-N |
| XLogP | 4.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |