C18H28N2O4 — CID 10854366
tert-butyl N-(4-hydroxybutyl)-N-[(2E)-2-phenylmethoxyiminoethyl]carbamate (PubChem CID 10854366) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is tert-butyl N-(4-hydroxybutyl)-N-[(2E)-2-phenylmethoxyiminoethyl]carbamate.
| Compound Name | tert-butyl N-(4-hydroxybutyl)-N-[(2E)-2-phenylmethoxyiminoethyl]carbamate |
|---|---|
| PubChem CID | 10854366 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | tert-butyl N-(4-hydroxybutyl)-N-[(2E)-2-phenylmethoxyiminoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C/C=N/OCc1ccccc1)CCCCO |
| InChI | InChI=1S/C18H28N2O4/c1-18(2,3)24-17(22)20(12-7-8-14-21)13-11-19-23-15-16-9-5-4-6-10-16/h4-6,9-11,21H,7-8,12-15H2,1-3H3/b19-11+ |
| InChIKey | RCABEWASQZKLAQ-YBFXNURJSA-N |
| XLogP | 3.20 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|