C15H15Cl2N3O2 — CID 108558978
2-cyano-N-[1-(2,4-dichlorobenzoyl)piperidin-4-yl]acetamide (PubChem CID 108558978) has the molecular formula C15H15Cl2N3O2 and a molecular weight of 340.21 g/mol. Its IUPAC name is 2-cyano-N-[1-(2,4-dichlorobenzoyl)piperidin-4-yl]acetamide.
| Compound Name | 2-cyano-N-[1-(2,4-dichlorobenzoyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 108558978 |
| Molecular Formula | C15H15Cl2N3O2 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 2-cyano-N-[1-(2,4-dichlorobenzoyl)piperidin-4-yl]acetamide |
| SMILES | N#CCC(=O)NC1CCN(C(=O)c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C15H15Cl2N3O2/c16-10-1-2-12(13(17)9-10)15(22)20-7-4-11(5-8-20)19-14(21)3-6-18/h1-2,9,11H,3-5,7-8H2,(H,19,21) |
| InChIKey | YEWPKBONPBNWNO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |