C21H26N2O5S — CID 108570455
[3-[2-[(4-tert-butylphenyl)sulfonylamino]ethylcarbamoyl]phenyl] acetate (PubChem CID 108570455) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is [3-[2-[(4-tert-butylphenyl)sulfonylamino]ethylcarbamoyl]phenyl] acetate.
| Compound Name | [3-[2-[(4-tert-butylphenyl)sulfonylamino]ethylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108570455 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | [3-[2-[(4-tert-butylphenyl)sulfonylamino]ethylcarbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)NCCNS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C21H26N2O5S/c1-15(24)28-18-7-5-6-16(14-18)20(25)22-12-13-23-29(26,27)19-10-8-17(9-11-19)21(2,3)4/h5-11,14,23H,12-13H2,1-4H3,(H,22,25) |
| InChIKey | VVGCZAVEQFAGQA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|