C12H27NOSi — CID 10857250
2,2-dimethyl-N-(2-trimethylsilyloxyethyl)pent-4-en-1-amine (PubChem CID 10857250) has the molecular formula C12H27NOSi and a molecular weight of 229.44 g/mol. Its IUPAC name is 2,2-dimethyl-N-(2-trimethylsilyloxyethyl)pent-4-en-1-amine.
| Compound Name | 2,2-dimethyl-N-(2-trimethylsilyloxyethyl)pent-4-en-1-amine |
|---|---|
| PubChem CID | 10857250 |
| Molecular Formula | C12H27NOSi |
| Molecular Weight | 229.44 g/mol |
| Exact Mass | 229.19 |
| IUPAC Name | 2,2-dimethyl-N-(2-trimethylsilyloxyethyl)pent-4-en-1-amine |
| SMILES | C=CCC(C)(C)CNCCO[Si](C)(C)C |
| InChI | InChI=1S/C12H27NOSi/c1-7-8-12(2,3)11-13-9-10-14-15(4,5)6/h7,13H,1,8-11H2,2-6H3 |
| InChIKey | QKUGSRGDEWROBG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|