C17H34O — CID 10858039
(4S,5R)-2-methyl-4-prop-1-en-2-yltridecan-5-ol (PubChem CID 10858039) has the molecular formula C17H34O and a molecular weight of 254.46 g/mol. Its IUPAC name is (4S,5R)-2-methyl-4-prop-1-en-2-yltridecan-5-ol.
| Compound Name | (4S,5R)-2-methyl-4-prop-1-en-2-yltridecan-5-ol |
|---|---|
| PubChem CID | 10858039 |
| Molecular Formula | C17H34O |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.26 |
| IUPAC Name | (4S,5R)-2-methyl-4-prop-1-en-2-yltridecan-5-ol |
| SMILES | C=C(C)[C@H](CC(C)C)[C@H](O)CCCCCCCC |
| InChI | InChI=1S/C17H34O/c1-6-7-8-9-10-11-12-17(18)16(15(4)5)13-14(2)3/h14,16-18H,4,6-13H2,1-3,5H3/t16-,17+/m0/s1 |
| InChIKey | HNEDPGQFQGOLLP-DLBZAZTESA-N |
| XLogP | 5.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|