C13H25NO3Si — CID 10858597
[(3aS,4S,5R)-4-methoxy-3a,4,5,6-tetrahydro-3H-cyclopenta[c][1,2]oxazol-5-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10858597) has the molecular formula C13H25NO3Si and a molecular weight of 271.43 g/mol. Its IUPAC name is [(3aS,4S,5R)-4-methoxy-3a,4,5,6-tetrahydro-3H-cyclopenta[c][1,2]oxazol-5-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aS,4S,5R)-4-methoxy-3a,4,5,6-tetrahydro-3H-cyclopenta[c][1,2]oxazol-5-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10858597 |
| Molecular Formula | C13H25NO3Si |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | [(3aS,4S,5R)-4-methoxy-3a,4,5,6-tetrahydro-3H-cyclopenta[c][1,2]oxazol-5-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CO[C@H]1[C@@H]2CON=C2C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H25NO3Si/c1-13(2,3)18(5,6)17-11-7-10-9(8-16-14-10)12(11)15-4/h9,11-12H,7-8H2,1-6H3/t9-,11-,12+/m1/s1 |
| InChIKey | UNGKJGBAICDXLU-JLLWLGSASA-N |
| XLogP | 2.80 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|