C18H32O4Si — CID 10860762
ethyl (E)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(2E)-penta-2,4-dienoxy]pent-2-enoate (PubChem CID 10860762) has the molecular formula C18H32O4Si and a molecular weight of 340.54 g/mol. Its IUPAC name is ethyl (E)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(2E)-penta-2,4-dienoxy]pent-2-enoate.
| Compound Name | ethyl (E)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(2E)-penta-2,4-dienoxy]pent-2-enoate |
|---|---|
| PubChem CID | 10860762 |
| Molecular Formula | C18H32O4Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | ethyl (E)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(2E)-penta-2,4-dienoxy]pent-2-enoate |
| SMILES | C=C/C=C/COC(/C=C/C(=O)OCC)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H32O4Si/c1-8-10-11-14-21-16(12-13-17(19)20-9-2)15-22-23(6,7)18(3,4)5/h8,10-13,16H,1,9,14-15H2,2-7H3/b11-10+,13-12+ |
| InChIKey | NLCXXMWEQSQLRD-AQASXUMVSA-N |
| XLogP | 4.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|